| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Glyceryl tribenzoate
-
-
2026-09-17
- CAS:614-33-5
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 500kg/month
- GLYCERYL TRIBENZOATE
-
- $1.00
-
2026-03-20
- CAS:614-33-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10 mt
|
| | Glyceryl tribenzoate Basic information |
| Product Name: | Glyceryl tribenzoate | | Synonyms: | 1,2,3-Propanetriyltribenzoate;Benzoflex S-404;Tri benzoic acid glyceryl ester;1,3-bis(benzoyloxy)propan-2-yl benzoate;1,3-bis(phenylcarbonyloxy)propan-2-yl benzoate;benzoic acid [2-(benzoyloxy)-1-(benzoyloxymethyl)ethyl] ester;1,2,3-Propanetriol,1,2,3-tribenzoate;Glyceryl tribenzoate 95% | | CAS: | 614-33-5 | | MF: | C24H20O6 | | MW: | 404.41 | | EINECS: | 210-379-6 | | Product Categories: | | | Mol File: | 614-33-5.mol |  |
| | Glyceryl tribenzoate Chemical Properties |
| Melting point | 68-72 °C (lit.) | | Boiling point | 486.04°C (rough estimate) | | density | 1.2280 | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.5200 (estimate) | | FEMA | 3398 | GLYCERYL TRIBENZOATE | | form | Solid:flakes | | Odor | at 100.00 %. plastic benzophenone balsamic clean green | | Odor Type | herbal | | JECFA Number | 861 | | Cosmetics Ingredients Functions | SKIN CONDITIONING FRAGRANCE | | InChI | InChI=1S/C24H20O6/c25-22(18-10-4-1-5-11-18)28-16-21(30-24(27)20-14-8-3-9-15-20)17-29-23(26)19-12-6-2-7-13-19/h1-15,21H,16-17H2 | | InChIKey | HIZCTWCPHWUPFU-UHFFFAOYSA-N | | SMILES | C(OC(=O)C1=CC=CC=C1)C(OC(=O)C1=CC=CC=C1)COC(=O)C1=CC=CC=C1 | | LogP | 4.928 at 25℃ and pH5 | | EPA Substance Registry System | 1,2,3-Propanetriol, tribenzoate (614-33-5) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | Glyceryl tribenzoate Usage And Synthesis |
| Chemical Properties | Glyceryl tribenzoate has a little or no odor. | | Uses | Plasticizer | | Definition | ChEBI: Glycerol tribenzoate is a benzoate ester. |
| | Glyceryl tribenzoate Preparation Products And Raw materials |
|