| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(1'-Carboxyl-cyclopropyl)phenylboronic acid Basic information |
| Product Name: | 4-(1'-Carboxyl-cyclopropyl)phenylboronic acid | | Synonyms: | 1-(4-Boronophenyl)cyclopropanecarboxylic acid;1-[4-(dihydroxyboryl)phenyl]cyclopropanecarboxylic acid;4-(1-Carboxycyclopropyl)phenylboronic acid;1-(4-boronophenyl)cyclopropane-1-carboxylicacid;EOS-60829;Cyclopropanecarboxylic acid, 1-(4-boronophenyl)-;1-(4-Boronophenyl)cyclopropane-1-carboxylic acid - [B93185];4-(1-carboxyclopropyl)benzeneboronic acid | | CAS: | 1159489-46-9 | | MF: | C10H11BO4 | | MW: | 206 | | EINECS: | | | Product Categories: | | | Mol File: | 1159489-46-9.mol |  |
| | 4-(1'-Carboxyl-cyclopropyl)phenylboronic acid Chemical Properties |
| Boiling point | 445.1±55.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 4.23±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C10H11BO4/c12-9(13)10(5-6-10)7-1-3-8(4-2-7)11(14)15/h1-4,14-15H,5-6H2,(H,12,13) | | InChIKey | PUBSPRJVEBBDPX-UHFFFAOYSA-N | | SMILES | OB(C1=CC=C(C2(C(O)=O)CC2)C=C1)O |
| HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-(1'-Carboxyl-cyclopropyl)phenylboronic acid Usage And Synthesis |
| | 4-(1'-Carboxyl-cyclopropyl)phenylboronic acid Preparation Products And Raw materials |
|