|
|
| | 2H-Pyrano[2,3-b]quinoline, 3,4-dihydro-2,5,6,8-tetramethyl- Basic information |
| Product Name: | 2H-Pyrano[2,3-b]quinoline, 3,4-dihydro-2,5,6,8-tetramethyl- | | Synonyms: | 2H-Pyrano[2,3-b]quinoline, 3,4-dihydro-2,5,6,8-tetramethyl-;2,5,6,8-Tetramethyl-3,4-dihydro-2H-pyrano[2,3-b]quinoline | | CAS: | 1771764-64-7 | | MF: | C16H19NO | | MW: | 241.33 | | EINECS: | | | Product Categories: | | | Mol File: | 1771764-64-7.mol | ![2H-Pyrano[2,3-b]quinoline, 3,4-dihydro-2,5,6,8-tetramethyl- Structure](CAS/20210111/GIF/1771764-64-7.gif) |
| | 2H-Pyrano[2,3-b]quinoline, 3,4-dihydro-2,5,6,8-tetramethyl- Chemical Properties |
| Boiling point | 404.3±24.0 °C(Predicted) | | density | 1.079±0.06 g/cm3(Predicted) | | form | powder | | pka | 5.01±0.40(Predicted) | | InChI | 1S/C16H19NO/c1-9-7-10(2)15-12(4)13-6-5-11(3)18-16(13)17-14(15)8-9/h7-8,11H,5-6H2,1-4H3 | | InChIKey | LOKRNFHHPZEJLL-UHFFFAOYSA-N | | SMILES | CC1=C2C(OC(C)CC2)=NC3=C1C(C)=CC(C)=C3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2H-Pyrano[2,3-b]quinoline, 3,4-dihydro-2,5,6,8-tetramethyl- Usage And Synthesis |
| Uses | The Yu Fluorination Ligand in tandem with Selectfluor(R) (Aldrich 439479) under palladium catalysis can promote direct fluorination of C(sp3)-H bonds stereoselectively. Yu and coworkers have displayed this on amino acid derivatives with directing group assistance from the Yu-Wasa Auxiliary (Aldrich 791806). | | General Description | Yu Fluorination Ligand is widely employed for the chemoselective functionalization of sp2- and sp3 C-H bonds. | | reaction suitability | reagent type: catalyst reagent type: ligand reaction type: C-H Activation |
| | 2H-Pyrano[2,3-b]quinoline, 3,4-dihydro-2,5,6,8-tetramethyl- Preparation Products And Raw materials |
|