| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
|
| | 1H-Imidazole-5-carboxamide, 1-methyl-4-(methylamino)-N-(5-oxohexyl)- Basic information |
| | 1H-Imidazole-5-carboxamide, 1-methyl-4-(methylamino)-N-(5-oxohexyl)- Chemical Properties |
| Boiling point | 555.7±45.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 14.87±0.46(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C12H20N4O2/c1-9(17)6-4-5-7-14-12(18)10-11(13-2)15-8-16(10)3/h8,13H,4-7H2,1-3H3,(H,14,18) | | InChIKey | KCZDJHHSQSZJFF-UHFFFAOYSA-N | | SMILES | C1N(C)C(C(NCCCCC(=O)C)=O)=C(NC)N=1 |
| | 1H-Imidazole-5-carboxamide, 1-methyl-4-(methylamino)-N-(5-oxohexyl)- Usage And Synthesis |
| | 1H-Imidazole-5-carboxamide, 1-methyl-4-(methylamino)-N-(5-oxohexyl)- Preparation Products And Raw materials |
|