| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-(4-Hydroxyphenylazo)benzoic acid Basic information |
| | 2-(4-Hydroxyphenylazo)benzoic acid Chemical Properties |
| Melting point | 204-208 °C(lit.) | | Boiling point | 385.05°C (rough estimate) | | density | 1.2480 (rough estimate) | | refractive index | 1.5300 (estimate) | | storage temp. | Store below +30°C. | | solubility | ethanol: 20 mg/mL, clear | | pka | 3.40±0.36(Predicted) | | form | powder to crystal | | color | Light yellow to Brown | | BRN | 1842696 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | 1S/C13H10N2O3/c16-10-7-5-9(6-8-10)14-15-12-4-2-1-3-11(12)13(17)18/h1-8,16H,(H,17,18)/b15-14+ | | InChIKey | DWQOTEPNRWVUDA-CCEZHUSRSA-N | | SMILES | Oc1ccc(cc1)\N=N\c2ccccc2C(O)=O | | CAS DataBase Reference | 1634-82-8(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2-[(4-hydroxyphenyl)azo]- (1634-82-8) | | Absorption | ≥2000 at 337nm (mol. absorption) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29270000 | | Storage Class | 11 - Combustible Solids |
| | 2-(4-Hydroxyphenylazo)benzoic acid Usage And Synthesis |
| Chemical Properties | light yellow to orange powder | | Uses | 2-(4-Hydroxyphenylazo)benzoic acid may be used in the preparation of:
- 2-((4-(3,4-dicyanophenoxy)phenyl)diazenyl)benzoic acid
- 2,2′-((((4,5-dicyano-1,2-phenylene)bis(oxy))bis(4,1-phenylene))bis(diazene-2,1-diyl)) dibenzoic acid
- a multifunctional benzoxazine monomer
| | Definition | ChEBI: An azo compound that is azobenzene in which one phenyl group is substituted at position 4 by a hydroxy group, while the other phenyl group is substituted at position 2 by a carboxy group. It is used as a matrix in matrix-assisted laser desorption/ionizatio
(MALDI) mass spectrometry. | | General Description | 2-(4-Hydroxyphenylazo)benzoic acid) (HABA), can be used for desorption of proteins, peptides and glycoproteins, thereby making it very advantageous for matrix-assisted laser desorption ionization mass spectrometry. |
| | 2-(4-Hydroxyphenylazo)benzoic acid Preparation Products And Raw materials |
|