- Gartanin
-
- $93.00
-
2026-07-27
- CAS:33390-42-0
- Purity: 99.64%
- Supply Ability: 10g
- Gartanin
-
-
2026-02-02
- CAS:33390-42-0
- Min. Order: 5mg
- Purity: 99%HPLC
- Supply Ability: 2000tons
|
| | 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one Basic information |
| Product Name: | 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one | | Synonyms: | 1,3,5,8-tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9h-xanthen-9-one;1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)xanthone;9H-Xanthen-9-one, 1,3,5,8-tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-;Aids098106;Aids-098106;1,3,5,8-Tetrahydroxy-2,4-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one;Gartanin, 98%, from Garcinia mangostana L.;9H-Xanthen-9-one, 1,3,5,8-tetrahydroxy-2,4-bis(3-methyl-2-buten-1-yl)- | | CAS: | 33390-42-0 | | MF: | C23H24O6 | | MW: | 396.43 | | EINECS: | | | Product Categories: | | | Mol File: | 33390-42-0.mol |  |
| | 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one Chemical Properties |
| Melting point | 167℃ | | Boiling point | 644.4±55.0 °C(Predicted) | | density | 1.326±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Chloroform: soluble | | form | A solid | | pka | 7.17±0.20(Predicted) | | color | Light yellow to yellow | | InChI | 1S/C23H24O6/c1-11(2)5-7-13-19(26)14(8-6-12(3)4)22-18(20(13)27)21(28)17-15(24)9-10-16(25)23(17)29-22/h5-6,9-10,24-27H,7-8H2,1-4H3 | | InChIKey | OJXQLGQIDIPMTE-UHFFFAOYSA-N | | SMILES | O=C1C2=C(O)C(CC=C(C)C)=C(O)C(CC=C(C)C)=C2OC3=C1C(O)=CC=C3O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one Usage And Synthesis |
| Uses | 1,3,5,8-Tetrahydroxy-2,4-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one is an anti-proliferative compound. An isoprenylated xanthone which is an androgen receptor degradation enhancer. A potential neuroprotective agent. | | Definition | ChEBI: A member of the class of xanthones that is 9H-xanthen-9-one substituted by hydroxy groups at positions 1, 3, 5 and 8 and prenyl groups at positions 2 and 4. |
| | 1,3,5,8-Tetrahydroxy-2,4-bis(3-methyl-2-butenyl)-9H-xanthen-9-one Preparation Products And Raw materials |
|