| Company Name: |
T&W GROUP Gold |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,6-Bis-tert-butyl-4-methylcyclohexanol Basic information | | Physical Form |
| Product Name: | 2,6-Bis-tert-butyl-4-methylcyclohexanol | | Synonyms: | 2,6-Bis-tert-butyl-4-methylcyclohexanol;2,6-bis(1,1-dimethylethyl)-4-methylcyclohexanol;2,6-Di-tert-butyl-4-methylcyclohexanol;2,6-Bis-tert-butyl-4;1,3-Di(tert-butyl)-2-hydroxy-5-methylcyclohexane;4-METHYL-2,6-BIS(2-METHYL-2-PROPANYL)CYCLOHEXANOL;Cyclohexanol, 2,6-bis(1,1-dimethylethyl)-4-methyl;2,6-ditert-butyl-4-methyl-1-cyclohexanol | | CAS: | 163119-16-2 | | MF: | C15H30O | | MW: | 226.4 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 163119-16-2.mol |  |
| | 2,6-Bis-tert-butyl-4-methylcyclohexanol Chemical Properties |
| Boiling point | 270°C | | density | 0.884 | | Fp | 112°C | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | pka | 15.36±0.70(Predicted) | | color | Colourless | | InChI | InChI=1S/C15H30O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7/h10-13,16H,8-9H2,1-7H3 | | InChIKey | OIXQKWDQCODZGF-UHFFFAOYSA-N | | SMILES | C1(O)C(C(C)(C)C)CC(C)CC1C(C)(C)C | | EPA Substance Registry System | Cyclohexanol, 2,6-bis(1,1-dimethylethyl)-4-methyl- (163119-16-2) |
| TSCA | TSCA listed | | HS Code | 2906120000 |
| | 2,6-Bis-tert-butyl-4-methylcyclohexanol Usage And Synthesis |
| Physical Form | Solid or liquid | | Uses | 2,6-ditert-butyl-4-methylcyclohexan-1-ol is a useful research chemical. |
| | 2,6-Bis-tert-butyl-4-methylcyclohexanol Preparation Products And Raw materials |
|