|
|
| | N,N'-bis-(2-Chloroethyl)urea Basic information |
| Product Name: | N,N'-bis-(2-Chloroethyl)urea | | Synonyms: | Carmustine Related Compound A (10 mg) (1,3-bis(2-chloroethyl)urea);CarMustine Related CoMpound A;BCU;NSC 36198;3-(diethylamino)-1-(2,4,6-trimethoxyphenyl)-1-propanone;Carmustine impurity A CRS;Carmustine impurity A (C0580010);Urea, N,N'-bis(2-chloroethyl)- | | CAS: | 2214-72-4 | | MF: | C5H10Cl2N2O | | MW: | 185.05 | | EINECS: | | | Product Categories: | Mutagenesis Research Chemicals | | Mol File: | 2214-72-4.mol |  |
| | N,N'-bis-(2-Chloroethyl)urea Chemical Properties |
| Melting point | 128-129 °C | | Boiling point | 358.2±27.0 °C(Predicted) | | density | 1.245±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 12.99±0.46(Predicted) | | Appearance | White to off-white Solid | | Stability: | Hygroscopic, Unstable in Solution | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C5H10Cl2N2O/c6-1-3-8-5(10)9-4-2-7/h1-4H2,(H2,8,9,10) | | InChIKey | VBWBRZHAGLZNST-UHFFFAOYSA-N | | SMILES | N(CCCl)C(NCCCl)=O |
| WGK Germany | WGK 3 | | HS Code | 2924190002 | | Storage Class | 11 - Combustible Solids |
| | N,N'-bis-(2-Chloroethyl)urea Usage And Synthesis |
| Uses | 1,3-Bis(2-chloroethyl)urea is an impurity in the synthesis of Carmustine (C183875), an alkylating and carbamoylating nitrosourea compound. It interacts with DNA, RNA and proteins causing DNA interstrand cross linking which is cytotoxic and leads to apoptotic cell death. |
| | N,N'-bis-(2-Chloroethyl)urea Preparation Products And Raw materials |
|