dimethyl 5,5'-methylenedianthranilate manufacturers
|
| | dimethyl 5,5'-methylenedianthranilate Basic information |
| Product Name: | dimethyl 5,5'-methylenedianthranilate | | Synonyms: | dimethyl 5,5'-methylenedianthranilate;Benzoic acid, 3,3-methylenebis6-amino-, dimethyl ester;3,3'-methylenebis(6-aminobenzoic acid), dimethyl ester;Benzoic acid, 3,3'-methylenebis[6-amino-, 1,1'-dimethyl ester;dimethyl 5,5'-methylenebis(2-aminobenzoate) | | CAS: | 31383-81-0 | | MF: | C17H18N2O4 | | MW: | 314.34 | | EINECS: | 250-606-6 | | Product Categories: | | | Mol File: | 31383-81-0.mol |  |
| | dimethyl 5,5'-methylenedianthranilate Chemical Properties |
| Melting point | 144-145 °C | | Boiling point | 501.2±50.0 °C(Predicted) | | density | 1.261±0.06 g/cm3(Predicted) | | pka | 2.91±0.25(Predicted) | | InChI | InChI=1S/C17H18N2O4/c1-22-16(20)12-8-10(3-5-14(12)18)7-11-4-6-15(19)13(9-11)17(21)23-2/h3-6,8-9H,7,18-19H2,1-2H3 | | InChIKey | XEZPSTVEIZNGRR-UHFFFAOYSA-N | | SMILES | C1(C(=O)OC)=C(N)C=CC(CC2C=CC(N)=C(C(=O)OC)C=2)=C1 | | EPA Substance Registry System | Benzoic acid, 3,3'-methylenebis[6-amino-, dimethyl ester (31383-81-0) |
| | dimethyl 5,5'-methylenedianthranilate Usage And Synthesis |
| Definition | ChEBI: 2-amino-5-[(4-amino-3-methoxycarbonylphenyl)methyl]benzoic acid methyl ester is a diarylmethane. |
| | dimethyl 5,5'-methylenedianthranilate Preparation Products And Raw materials |
|