| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
5,5'-Methylenebis(2-aminobenzoic Acid) manufacturers
|
| | 5,5'-Methylenebis(2-aminobenzoic Acid) Basic information |
| Product Name: | 5,5'-Methylenebis(2-aminobenzoic Acid) | | Synonyms: | AKOS BBS-00003100;CHEMBRDG-BB 5180504;6,6'-Diamino-3,3'-methanediyl-di-benzoic acid;METHYLENE BIS (ANTHRANILIC ACID);5,5'-methylenedianthranilic acid;3,3'-Methylenebis(6-aminobenzoic acid);5,5'-Methylenebis(anthanilic acid);Aids019264 | | CAS: | 7330-46-3 | | MF: | C15H14N2O4 | | MW: | 286.28 | | EINECS: | 230-830-0 | | Product Categories: | PI | | Mol File: | 7330-46-3.mol |  |
| | 5,5'-Methylenebis(2-aminobenzoic Acid) Chemical Properties |
| Melting point | 262℃ (water acetic acid ) | | Boiling point | 576.4±50.0 °C(Predicted) | | density | 1.442±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 2.24±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C15H14N2O4/c16-12-3-1-8(6-10(12)14(18)19)5-9-2-4-13(17)11(7-9)15(20)21/h1-4,6-7H,5,16-17H2,(H,18,19)(H,20,21) | | InChIKey | QRUWUSOUUMPANJ-UHFFFAOYSA-N | | SMILES | C(C1C=CC(N)=C(C=1)C(O)=O)C1C=CC(N)=C(C=1)C(O)=O |
| | 5,5'-Methylenebis(2-aminobenzoic Acid) Usage And Synthesis |
| Uses | 5,5'-Methylenebis(2-aminobenzoic Acid) (MBA) is a polymer monomer used in the synthesis of polyimides. |
| | 5,5'-Methylenebis(2-aminobenzoic Acid) Preparation Products And Raw materials |
|