| Company Name: |
Ningbo jinuo chemical co., LTD
|
| Tel: |
0574-87314919 057487319282 |
| Email: |
info@nbinno.com |
| Products Intro: |
Product Name:quinoline yellow CAS:83-08-9
|
| Company Name: |
Shaoyuan Technology (Shanghai) Co., Ltd.
|
| Tel: |
021-50795510 4000665055 |
| Email: |
sy-c5@accelachem.com |
| Products Intro: |
Product Name:2-(Quinolin-2-yl)-1H-indene-1,3(2H)-dione CAS:83-08-9 Purity:>=95% Package:1g
|
|
| | 2-(2-quinolyl)-1H-indene-1,3(2H)-dione Basic information |
| Product Name: | 2-(2-quinolyl)-1H-indene-1,3(2H)-dione | | Synonyms: | 3(2H)-dione, 2-(2-quinolinyl)-1H-Indene-1;2-(2-quinolyl)indane-1,3-quinone;Quinoline Yellow 2SF;2-(quinolin-2-yl)-1H-indene-1,3(2H)-dione;2-(2-quinolyl)-1H-indene-1,3(2H)-dione;quinophthalone;1H-Indene-1,3(2H)-dione,2-(2-quinolinyl)-;2-(2-quinolinyl)-1h-indene-3(2h)-dione | | CAS: | 83-08-9 | | MF: | C18H11NO2 | | MW: | 273.29 | | EINECS: | 201-453-9 | | Product Categories: | | | Mol File: | 83-08-9.mol |  |
| | 2-(2-quinolyl)-1H-indene-1,3(2H)-dione Chemical Properties |
| Melting point | 239 °C(Solv: ethanol (64-17-5)) | | Boiling point | 514.5±50.0 °C(Predicted) | | density | 1.345±0.06 g/cm3(Predicted) | | pka | -0.74±0.20(Predicted) | | Cosmetics Ingredients Functions | COLORANT | | InChI | 1S/C18H11NO2/c20-17-12-6-2-3-7-13(12)18(21)16(17)15-10-9-11-5-1-4-8-14(11)19-15/h1-10,16H | | InChIKey | IZMJMCDDWKSTTK-UHFFFAOYSA-N | | SMILES | O=C1C2=C(C=CC=C2)C(C1C3=NC4=CC=CC=C4C=C3)=O | | EPA Substance Registry System | 1H-Indene-1,3(2H)-dione, 2-(2-quinolinyl)- (83-08-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-(2-quinolyl)-1H-indene-1,3(2H)-dione Usage And Synthesis |
| Uses | Quinoline yellow 2SF is a multifunctional dye. Dyes are important tools in biological experiments. They can help researchers observe and analyze cell structures, track biomolecules, evaluate cell functions, distinguish cell types, detect biomolecules, study tissue pathology and monitor microorganisms. Their applications range from basic scientific research to clinical A wide range of diagnostics. Dyes are also widely used in traditional fields such as textile dyeing, as well as in emerging fields such as functional textile processing, food pigments and dye-sensitized solar cells. | | Definition | ChEBI: A quinoline derivative with a 1,3-dioxoindan-2-yl substituent at C-2. | | References | [1] Sultana M, et al. A review on experimental chemically modified activated carbon to enhance dye and heavy metals adsorption[J]. Cleaner engineering and technology, 2022, 6: 100382. |
| | 2-(2-quinolyl)-1H-indene-1,3(2H)-dione Preparation Products And Raw materials |
|