|
|
| | 3-[o-(alpha,alpha,alpha-trifluorotolyl)]propionic acid Basic information |
| | 3-[o-(alpha,alpha,alpha-trifluorotolyl)]propionic acid Chemical Properties |
| Melting point | 84-88 °C | | Boiling point | 266.9±35.0 °C(Predicted) | | density | 1.307±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.53±0.10(Predicted) | | color | White | | InChI | InChI=1S/C10H9F3O2/c11-10(12,13)8-4-2-1-3-7(8)5-6-9(14)15/h1-4H,5-6H2,(H,14,15) | | InChIKey | YTDVNFDGHHHPEE-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)=CC=CC=C1C(F)(F)F |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Hazard Note | Harmful | | TSCA | Yes | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-[o-(alpha,alpha,alpha-trifluorotolyl)]propionic acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 3-[2-(Trifluoromethyl)phenyl]propionic Acid is a reactant used in the synthesis of small molecule inhibitors of anthrax toxin. | | Definition | ChEBI: A monocarboxylic acid comprising propionic acid having a 2-(trifluoromethyl)phenyl group at the 3-position. |
| | 3-[o-(alpha,alpha,alpha-trifluorotolyl)]propionic acid Preparation Products And Raw materials |
|