| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-(Trifluoromethyl)hydrocinnamic acid Basic information |
| Product Name: | 4-(Trifluoromethyl)hydrocinnamic acid | | Synonyms: | 3-[4-(TRIFLUOROMETHYL)PHENYL]PROPIONIC ACID;4-(Trifluoromethyl)HydrocinnamicAcid/P-(Trifluoromethyl)PhenylpropionicAcid/P-(Trifluoromethylphenyl)PropionicAcid;4-(TRIFLUOROMETHYL)HYDROCINNAMIC ACID 95%;P-Trifluoromethyl benzylacetic acid;4-(TRIFLUOROMETHYL)PHENYLPROPIONIC ACID;4-(Trifluoromethyl)hydrocinnamic acid,95%;3-(4-(Trifluoromethyl)phenyl)propanoic acid ,97%;4-(TrifluoroMethyl)-benzenepropanoic acid | | CAS: | 53473-36-2 | | MF: | C10H9F3O2 | | MW: | 218.17 | | EINECS: | 256-495-9 | | Product Categories: | Fluorine series;Acids and Derivatives | | Mol File: | 53473-36-2.mol |  |
| | 4-(Trifluoromethyl)hydrocinnamic acid Chemical Properties |
| Melting point | 106-110 °C(lit.) | | Boiling point | 0°C | | density | 1.307±0.06 g/cm3(Predicted) | | Fp | 0°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 4.54±0.10(Predicted) | | form | Crystalline Powder or Solid | | color | White to light brown | | InChI | InChI=1S/C10H9F3O2/c11-10(12,13)8-4-1-7(2-5-8)3-6-9(14)15/h1-2,4-5H,3,6H2,(H,14,15) | | InChIKey | OEIUMLSCWINLBB-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)=CC=C(C(F)(F)F)C=C1 | | CAS DataBase Reference | 53473-36-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 |
| | 4-(Trifluoromethyl)hydrocinnamic acid Usage And Synthesis |
| Chemical Properties | White to pale yellow crystalline powder | | Uses | 4-(Trifluoromethyl)hydrocinnamic Acid acts as a reagent in the synthesis of (poly)fluorinated neprilysin inhibitor. It is also applied in pesticides, medicines, dyes and in functional materials preparation because of it’s excellent bioactive properties. | | Synthesis | GENERAL STEPS: (E)-4-Trifluoromethylcinnamic acid (10.0 g, 46.3 mmol) was mixed with 10 wt% Pd/C catalyst (250 mg) in ethanol (100 mL). The reaction mixture was placed under hydrogen atmosphere (6 bar) and the reaction was stirred at room temperature for 21 hours. Upon completion of the reaction, the catalyst was removed by filtration through a diatomaceous earth pad and the filtrate was concentrated under reduced pressure to remove the solvent to afford 3-(4-trifluoromethyl)phenylpropionic acid as a white solid (10.1 g, 46.1 mmol, 100% yield). The structure of the product was confirmed by 1H-NMR (CDCl3): δ 2.73 (t, J = 7.6 Hz, 2H), 3.03 (t, J = 7.6 Hz, 2H), 7.33 (d, J = 8.0 Hz, 2H), 7.56 (d, J = 8.1 Hz, 2H). | | References | [1] Patent: WO2010/64212, 2010, A1. Location in patent: Page/Page column 23 [2] Canadian Journal of Chemistry, 2012, vol. 90, # 9, p. 758 - 761 [3] Bioorganic and Medicinal Chemistry, 2009, vol. 17, # 10, p. 3557 - 3567 [4] Patent: US2010/10226, 2010, A1. Location in patent: Page/Page column 7-8 [5] Patent: US2010/305325, 2010, A1. Location in patent: Page/Page column 2; 3; 8 |
| | 4-(Trifluoromethyl)hydrocinnamic acid Preparation Products And Raw materials |
|