- Dacisteine
-
- $41.00 / 25mg
-
2026-04-25
- CAS:18725-37-6
- Min. Order:
- Purity: 99.71%
- Supply Ability: 10g
|
| | dacisteine Basic information |
| | dacisteine Chemical Properties |
| Melting point | 114-116°C | | Boiling point | 446.8±40.0 °C(Predicted) | | density | 1.314±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.15±0.10(Predicted) | | color | White to Off-White | | Major Application | (pharmaceutical small molecule) | | InChI | InChI=1S/C7H11NO4S/c1-4(9)8-6(7(11)12)3-13-5(2)10/h6H,3H2,1-2H3,(H,8,9)(H,11,12)/t6-/m0/s1 | | InChIKey | HSPYGHDTVQJUDE-LURJTMIESA-N | | SMILES | C(O)(=O)[C@H](CSC(C)=O)NC(C)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | dacisteine Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | N,S-Diacetyl-L-cysteine (Acetylcysteine EP Impurity D) is a double-prodrugs of L-cysteine: differential protection against acetaminophen-induced hepatotoxicity in mice (1,2,3). | | Definition | ChEBI: Dacisteine is a N-acyl-L-amino acid. |
| | dacisteine Preparation Products And Raw materials |
|