diisopropyl maleate manufacturers
- diisopropyl maleate
-
-
2026-06-30
- CAS:10099-70-4
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | diisopropyl maleate Basic information |
| Product Name: | diisopropyl maleate | | Synonyms: | (Z)-2-Butenedioic acid di(1-methylethyl) ester;(Z)-2-Butenedioic acid diisopropyl ester;Maleic acid diisopropyl;Maleic acid diisopropyl ester;2-Butenedioic acid (2Z)-, bis(1-Methylethyl) ester;diisopropyl maleate;Brivaracetam Impurity 42;2-Butenedioic acid (2Z)-, 1,4-bis(1-methylethyl) ester | | CAS: | 10099-70-4 | | MF: | C10H16O4 | | MW: | 200.23 | | EINECS: | 233-242-2 | | Product Categories: | | | Mol File: | 10099-70-4.mol |  |
| | diisopropyl maleate Chemical Properties |
| Melting point | -30.15°C | | Boiling point | 257.96°C (rough estimate) | | density | 0.9941 (rough estimate) | | vapor pressure | 6.2Pa at 25℃ | | refractive index | 1.4500 (estimate) | | Water Solubility | 9.9g/L at 20℃ | | InChI | InChI=1S/C10H16O4/c1-7(2)13-9(11)5-6-10(12)14-8(3)4/h5-8H,1-4H3/b6-5- | | InChIKey | FNMTVMWFISHPEV-WAYWQWQTSA-N | | SMILES | C(OC(C)C)(=O)/C=C\C(OC(C)C)=O | | LogP | 1.95 | | EPA Substance Registry System | 2-Butenedioic acid (2Z)-, bis(1-methylethyl) ester (10099-70-4) |
| | diisopropyl maleate Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | diisopropyl maleate Preparation Products And Raw materials |
|