2',4'-dimethoxychalcone manufacturers
|
| | 2',4'-dimethoxychalcone Basic information |
| Product Name: | 2',4'-dimethoxychalcone | | Synonyms: | 1-(2,4-Dimethoxyphenyl)-3-phenyl-2-propen-1-one;2-Propen-1-one, 1-(2,4-dimethoxyphenyl)-3-phenyl-;Chalcone, 2',4'-dimethoxy-;Einecs 214-577-3;(2E)-1-(2,4-Dimethoxyphenyl)-3-phenylprop-2-en-1-one;2',4'-dimethoxychalcone | | CAS: | 1154-77-4 | | MF: | C17H16O3 | | MW: | 268.31 | | EINECS: | 214-577-3 | | Product Categories: | | | Mol File: | 1154-77-4.mol |  |
| | 2',4'-dimethoxychalcone Chemical Properties |
| Melting point | 78 °C | | Boiling point | 446.1±45.0 °C(Predicted) | | density | 1.128±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C17H16O3/c1-19-14-9-10-15(17(12-14)20-2)16(18)11-8-13-6-4-3-5-7-13/h3-12H,1-2H3/b11-8+ | | InChIKey | ZRDCNUALRUCCPA-DHZHZOJOSA-N | | SMILES | COc1ccc(C(=O)\C=C\c2ccccc2)c(OC)c1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2',4'-dimethoxychalcone Usage And Synthesis |
| | 2',4'-dimethoxychalcone Preparation Products And Raw materials |
|