- 5,7-DIMETHOXYFLAVONE
-
- $72.00 / 25mg
-
2026-01-26
- CAS:21392-57-4
- Min. Order:
- Purity: 99.83%
- Supply Ability: 10g
- Black Ginger extract
-
- $0.00 / 1kg
-
2025-06-13
- CAS:21392-57-4
- Min. Order: 1kg
- Purity: 99.8%
- Supply Ability: 1000 kg
|
| | 5,7-DIMETHOXYFLAVONE Basic information | | Uses |
| | 5,7-DIMETHOXYFLAVONE Chemical Properties |
| Melting point | 150-152°C | | Boiling point | 476.6±45.0 °C(Predicted) | | density | 1.242±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | Off-White to Pale Brown | | InChI | InChI=1S/C17H14O4/c1-19-12-8-15(20-2)17-13(18)10-14(21-16(17)9-12)11-6-4-3-5-7-11/h3-10H,1-2H3 | | InChIKey | JRFZSUMZAUHNSL-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)OC2=CC(OC)=CC(OC)=C2C(=O)C=1 | | LogP | 3.270 (est) | | CAS DataBase Reference | 21392-57-4(CAS DataBase Reference) |
| | 5,7-DIMETHOXYFLAVONE Usage And Synthesis |
| Uses | 5,7-Dimethoxy-2-phenylchromen-4-one is potential therapeutic agents, Polymethoxylated Flavones Isolated from Kaempferia Parviflora for cataract prevention through inhibition of matrix metalloproteinase-9 in lens epithelial cells. | | Chemical Properties | White crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Celosia cristata; Buttercup flower. | | Uses | 5,7-Dimethoxy-2-phenylchromen-4-one is potential therapeutic agents, Polymethoxylated Flavones Isolated from Kaempferia Parviflora for cataract prevention through inhibition of matrix metalloproteinase-9 in lens epithelial cells. | | Definition | ChEBI: A dimethoxyflavone that is the 5,7-dimethyl ether derivative of chrysin. |
| | 5,7-DIMETHOXYFLAVONE Preparation Products And Raw materials |
| Raw materials | 1,3-Propanedione, 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenyl--->4H-1-Benzopyran-4-one, 2-chloro-5,7-dimethoxy--->1-(2-HYDROXY-4,6-DIMETHOXY-PHENYL)-3-PHENYL-PROPAN-1-ONE-->2’,4’-Dimethoxy-2-hydroxyacetophenone-->5,6-DIHYDROXYFLAVONE-->4H-1-benzopyran-4-one, 2,3-dihydro-5,7-diMethoxy--->2',4'-dimethoxychalcone-->4',6'-DIMETHOXY-2'-HYDROXYCHALCONE-->2'-HYDROXY-4',6'-DIMETHOXYACETOPHENONE-->Chrysin-->(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZENE-->Benzaldehyde-->Phenylboronic acid-->Dimethyl sulfate-->Iodomethane | | Preparation Products | 5-HYDROXY-7-METHOXYFLAVONE |
|