3,4-dimethylcyclopent-2-en-1-one manufacturers
|
| | 3,4-dimethylcyclopent-2-en-1-one Basic information |
| Product Name: | 3,4-dimethylcyclopent-2-en-1-one | | Synonyms: | 3,4-dimethylcyclopent-2-en-1-one;3,4-DIMETHYLCYCLOPENT-2-ENONE;3,4-Dimethyl-2-cyclopenten-1-one;Dimethyl-2-cyclopentenone-1;Einecs 250-199-5;3,4-dimethyl-2-cyclopentenone;2-Cyclopenten-1-one, 3,4-dimethyl- | | CAS: | 30434-64-1 | | MF: | C7H10O | | MW: | 110.15 | | EINECS: | 250-199-5 | | Product Categories: | | | Mol File: | 30434-64-1.mol |  |
| | 3,4-dimethylcyclopent-2-en-1-one Chemical Properties |
| Boiling point | 67-68 °C | | density | 0.945±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C7H10O/c1-5-3-7(8)4-6(5)2/h3,6H,4H2,1-2H3 | | InChIKey | XSOSLVVAKBKYRV-UHFFFAOYSA-N | | SMILES | C1(=O)CC(C)C(C)=C1 | | LogP | 0.837 (est) |
| | 3,4-dimethylcyclopent-2-en-1-one Usage And Synthesis |
| | 3,4-dimethylcyclopent-2-en-1-one Preparation Products And Raw materials |
|