| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Crotonic acid isopropyl ester Basic information |
| Product Name: | Crotonic acid isopropyl ester | | Synonyms: | ISOPROPYL CROTONATE;isopropyl (E)-but2-enoate;isopropyl (E)-crotonate;2-Butenoic acid, 1-methylethyl ester, (2E)-;Isopropyl Crotonate >Neratinib Impurity 23;Crotonic acid isopropyl ester | | CAS: | 6284-46-4 | | MF: | C7H12O2 | | MW: | 128.17 | | EINECS: | | | Product Categories: | | | Mol File: | 6284-46-4.mol |  |
| | Crotonic acid isopropyl ester Chemical Properties |
| Boiling point | 147 °C | | density | 0.89 | | refractive index | 1.4220-1.4250 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.89 | | InChI | InChI=1S/C7H12O2/c1-4-5-7(8)9-6(2)3/h4-6H,1-3H3/b5-4+ | | InChIKey | AABBHSMFGKYLKE-SNAWJCMRSA-N | | SMILES | C(OC(C)C)(=O)/C=C/C | | LogP | 2.195 (est) | | CAS DataBase Reference | 6284-46-4 |
| RIDADR | 3272 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2916199590 |
| | Crotonic acid isopropyl ester Usage And Synthesis |
| | Crotonic acid isopropyl ester Preparation Products And Raw materials |
|