|
|
| | dicopper hydroxide phosphate Basic information |
| | dicopper hydroxide phosphate Chemical Properties |
| form | powder | | Water Solubility | 47.3mg/L at 20℃ | | Major Application | battery manufacturing | | InChI | InChI=1S/2Cu.H3O4P.H2O/c;;1-5(2,3)4;/h;;(H3,1,2,3,4);1H2/q2*+2;;/p-4 | | InChIKey | WCMHCPWEQCWRSR-UHFFFAOYSA-J | | SMILES | P([O-])([O-])([O-])=O.O[Cu+].[Cu+2] | | LogP | -2.148 (est) | | EPA Substance Registry System | Copper hydroxide phosphate (Cu2(OH)(PO4)) (12158-74-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| | dicopper hydroxide phosphate Usage And Synthesis |
| Uses | battery manufacturing | | Flammability and Explosibility | Non flammable |
| | dicopper hydroxide phosphate Preparation Products And Raw materials |
|