|
|
| | 1-[2-(acetoxy)ethyl]-2-oxopropyl [(4-amino-2-methyl-5-pyrimidinyl)methyl]dithiocarbamate Basic information |
| | 1-[2-(acetoxy)ethyl]-2-oxopropyl [(4-amino-2-methyl-5-pyrimidinyl)methyl]dithiocarbamate Chemical Properties |
| Melting point | 250 °C (decomp) | | Boiling point | 556.7±60.0 °C(Predicted) | | density | 1.312±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 10.42±0.70(Predicted) | | color | Yellow | | Major Application | pharmaceutical | | InChI | 1S/C14H20N4O4S.CH3NOS/c1-8(19)12(4-5-22-10(3)20)23-14(21)17-7-11-6-16-9(2)18-13(11)15;2-1(3)4/h6,12H,4-5,7H2,1-3H3,(H,17,21)(H2,15,16,18);(H3,2,3,4)/p-1 | | InChIKey | CGOPORLNMBHBEL-UHFFFAOYSA-M | | SMILES | [S-]C(=O)N.S(C(CCOC(=O)C)C(=O)C)C(=O)NCc1c(nc(nc1)C)N |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | 1-[2-(acetoxy)ethyl]-2-oxopropyl [(4-amino-2-methyl-5-pyrimidinyl)methyl]dithiocarbamate Usage And Synthesis |
| Uses | Thiamine Thiocarbamate is a Thiamine (T344185) impurity. Thiamine is a essential nutrient required for carbohydrate metabolism; also involved in nerve function. |
| | 1-[2-(acetoxy)ethyl]-2-oxopropyl [(4-amino-2-methyl-5-pyrimidinyl)methyl]dithiocarbamate Preparation Products And Raw materials |
|