|
|
| | Thiothiamine Basic information |
| | Thiothiamine Chemical Properties |
| Melting point | 238-239 °C | | Boiling point | 509.6±60.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) | | form | Solid | | pka | 14.72±0.10(Predicted) | | color | Pale Beige to Light Brown | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C12H16N4OS2/c1-7-10(3-4-17)19-12(18)16(7)6-9-5-14-8(2)15-11(9)13/h5,17H,3-4,6H2,1-2H3,(H2,13,14,15) | | InChIKey | SQOCQQPFEFRKBV-UHFFFAOYSA-N | | SMILES | S1C(CCO)=C(C)N(CC2=CN=C(C)N=C2N)C1=S |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Thiothiamine Usage And Synthesis |
| Chemical Properties | Crystals. Melting point 239℃, its hydrochloride decomposes at 245℃. | | Uses | Thiothiamine is an impurity of Thiamine (T344185). Thiothiamine inhibits the activity of glutamate decarboxylase and decreases the concentration of GABA in brain tissue. Thiamine Impurity A; |
| | Thiothiamine Preparation Products And Raw materials |
|