| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
scillaren A manufacturers
- Scillaren A
-
-
2026-06-30
- CAS:124-99-2
- Min. Order: 1kg
- Purity: ≥90%
- Supply Ability: 1000kg
|
| | scillaren A Basic information |
| Product Name: | scillaren A | | Synonyms: | scillaren A;3β-[(4-O-β-D-Glucopyranosyl-6-deoxy-α-L-mannopyranosyl)oxy]-14-hydroxybufa-4,20,22-trienolide;Transvaalin;Transvalin;Bufa-4,20,22-trienolide, 3-[(6-deoxy-4-O-β-D-glucopyranosyl-α-L-mannopyranosyl)oxy]-14-hydroxy-, (3β)-;Scillaren A >=90% (LC/MS-ELSD);Scillaglykosid A;Scillaren | | CAS: | 124-99-2 | | MF: | C36H52O13 | | MW: | 692.79 | | EINECS: | 204-721-3 | | Product Categories: | | | Mol File: | 124-99-2.mol |  |
| | scillaren A Chemical Properties |
| Melting point | 184-186°; mp 208-211°; mp 230-240°; mp 270° | | alpha | D23 -71.9° (c = 1.011 in methanol); D20 -72 to -78° (c = 1 to 3 in 75% alcohol); D20 -73.8° | | Boiling point | 619.4°C (rough estimate) | | density | 1.1561 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | -20°C | | pka | 12.88±0.70(Predicted) | | form | solid | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChIKey | NXJOCELNFPGKIV-ARHXXGKOSA-N | | SMILES | C[C@@H]1O[C@@H](O[C@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)[C@H](CC[C@]5(O)[C@@H]4CCC3=C2)C6=COC(=O)C=C6)[C@H](O)[C@H](O)[C@H]1O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral | | Toxicity | LD50 i.v. in rats: 15.5 mg/kg (Vogel, Kluge) |
| | scillaren A Usage And Synthesis |
| Uses | Scillaren A is a steroidal glycoside obtained from Scilla maderensis Menezes (Hyacinthaceae), and is considered a cardiac glycoside used in the medical treatment of heart diseases. | | Biological Activity | Scillaren A might inhibit Na+/K+-ATPase. |
| | scillaren A Preparation Products And Raw materials |
|