|
|
| | 7-(5-amino-5-carboxyvaleramido)cephalosporanic acid Basic information |
| Product Name: | 7-(5-amino-5-carboxyvaleramido)cephalosporanic acid | | Synonyms: | 7-(5-amino-5-carboxyvaleramido)cephalosporanic acid;Cephalosporins-intermediate II;Cefodizime impurity 16;CAPHALOSPORIN C;5-Thia-1-azabicyclo4.2.0oct-2-ene-2-carboxylic acid, 3-(acetyloxy)methyl-7-(5R)-5-amino-5-carboxy-1-oxopentylamino-8-oxo-, (6R,7R)-;7-(D-5-Amino-5-carboxyvaleramido)-3-(hydrox-ymethyl)-8-oxo-5-thia-1-azabicyclo[4,2,0]oct-2-ene-2-Carboxylic acid acetate;(7R)-3-[(Acetyloxy)methyl]-7-[[(R)-5-carboxy-5-amino-1-oxopentyl)amino]cepham-3-ene-4-carboxylic acid;(7R)-3-[(Acetyloxy)methyl]-7-[[(R)-5-carboxy-5-amino-1-oxopentyl]amino]cepham-3-ene-4-carboxylic acid | | CAS: | 61-24-5 | | MF: | C16H21N3O8S | | MW: | 415.42 | | EINECS: | 200-501-6 | | Product Categories: | chemical | | Mol File: | 61-24-5.mol |  |
| | 7-(5-amino-5-carboxyvaleramido)cephalosporanic acid Chemical Properties |
| Boiling point | 814.7±65.0 °C(Predicted) | | density | 1.55±0.1 g/cm3(Predicted) | | pka | 2.49±0.24(Predicted) | | Optical Rotation | +10320 (H2O) | | InChIKey | HOKIDJSKDBPKTQ-GLXFQSAKSA-N | | SMILES | N12[C@@]([H])([C@H](NC(=O)CCC[C@@H](N)C(O)=O)C1=O)SCC(COC(C)=O)=C2C(O)=O |
| | 7-(5-amino-5-carboxyvaleramido)cephalosporanic acid Usage And Synthesis |
| Chemical Properties | Its sodium salt dihydrate is monoclinic crystal. Soluble in water, insoluble in ethanol, ether. Stable when aqueous solution pH2.5-8. | | Uses | 7-(5-Amino-5-carboxyvaleramido)cephalosporanic acid exhibits activity against Staphylococcus aureus, Salmonella typhi, and Escherichia coli. However, due to its low antibacterial activity, it is not widely used clinically. But through modification, highly efficient derivatives can be obtained, and it is currently mainly used as an intermediate in the preparation of 7-aminocephalosporinic acid (7-ACA). | | Definition | ChEBI: A cephalosporin antibiotic carrying a 3-acetoxymethyl substituent and a 6-oxo-N6-L-lysino group at position 7. |
| | 7-(5-amino-5-carboxyvaleramido)cephalosporanic acid Preparation Products And Raw materials |
|