|
|
| | 2-4-dimethylbutyrophenone Basic information |
| Product Name: | 2-4-dimethylbutyrophenone | | Synonyms: | 2-4-dimethylbutyrophenone;1-(2,4-dimethylphenyl)butan-1-one;1-Butanone, 1-(2,4-dimethylphenyl)-;1-(2,4-Dimethylphenyl)-1-butanone;2',4'-DIMETHYLBUTYROPHENONE | | CAS: | 35031-57-3 | | MF: | C12H16O | | MW: | 176.26 | | EINECS: | | | Product Categories: | | | Mol File: | 35031-57-3.mol |  |
| | 2-4-dimethylbutyrophenone Chemical Properties |
| Boiling point | 136-138 °C(Press: 5 Torr) | | density | 0.944±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C12H16O/c1-4-5-12(13)11-7-6-9(2)8-10(11)3/h6-8H,4-5H2,1-3H3 | | InChIKey | SXTXIWHKFWESDQ-UHFFFAOYSA-N | | SMILES | O=C(CCC)C1=C(C)C=C(C)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-4-dimethylbutyrophenone Usage And Synthesis |
| | 2-4-dimethylbutyrophenone Preparation Products And Raw materials |
|