- Diphenyldiazomethane
-
- $10.00
-
2026-09-04
- CAS:883-40-9
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 1 ton
- Diphenyldiazomethane
-
- $1.00
-
2020-02-20
- CAS:883-40-9
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 10Tons
|
| | Diphenyldiazomethane Basic information |
| Product Name: | Diphenyldiazomethane | | Synonyms: | (diazo-phenyl-methyl)benzene;1,1'-(Diazomethylene)bisbenzene;INTERMEDIATEOFCEFOSELISSULFATE;Bis(phenyl)diazomethane;(3R)-tert-butyl 3-(3-bromo-2-oxopyrrolidin-1-yl)pyrrolidine-1-carboxylate;Benzene, 1,1'-(diazoMethylene)bis-;3,3-diphenyldiazirine;1,1-Diphenyldiazomethane (> | | CAS: | 883-40-9 | | MF: | C13H10N2 | | MW: | 194.23 | | EINECS: | 202-303-5 | | Product Categories: | | | Mol File: | 883-40-9.mol |  |
| | Diphenyldiazomethane Chemical Properties |
| Melting point | 29-30 °C | | Boiling point | 320.68°C (rough estimate) | | density | 1.1579 (rough estimate) | | refractive index | 1.5014 (estimate) | | storage temp. | -20°C, Light sensitive | | solubility | Chloroform, Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | color | Red to Very Dark Purple | | Stability: | Possibly shock sensitive | | InChI | InChI=1S/C13H10N2/c1-3-7-11(8-4-1)13(14-15-13)12-9-5-2-6-10-12/h1-10H | | InChIKey | YSIXZOWGRJZVLY-UHFFFAOYSA-N | | SMILES | C1(N=N1)(C1C=CC=CC=1)C1=CC=CC=C1 |
| | Diphenyldiazomethane Usage And Synthesis |
| Description | A alkylating agent for carboxylic acids; reagent for the synthesis of diphenylcyclopropanes from alkenes. | | Chemical Properties | Dark red crystals, melting point 30℃. | | Uses | 1,1-Diphenyldiazomethane is used to synthesize tartaric acid analogs of FR258900 as glycogen phosphorylase inhibitors. | | Preparation | Diphenyldiazomethane is prepared by the oxidation of benzophenone hydrazone. | | Synthesis Reference(s) | Organic Syntheses, Coll. Vol. 3, p. 351, 1955 The Journal of Organic Chemistry, 60, p. 4725, 1995 DOI: 10.1021/jo00120a013 |
| | Diphenyldiazomethane Preparation Products And Raw materials |
|