|
|
| | L-Alanine-13C3, N-t-Boc derivative (99 & Basic information |
| Product Name: | L-Alanine-13C3, N-t-Boc derivative (99 & | | Synonyms: | boc-ala-oh-12c3;L-Alanine-13C3, N-t-Boc derivative, N-(tert-Butoxycarbonyl)-L-alanine-13C3;L-ALANINE-N-T-BOC (13C3);"L-Alanine-13C3, N-Boc";Boc-Ala-OH-13C3;L-Alanine-13C3, N-t-Boc derivative (99 & | | CAS: | 335081-02-2 | | MF: | C8H15NO4 | | MW: | 192.176 | | EINECS: | | | Product Categories: | | | Mol File: | 335081-02-2.mol |  |
| | L-Alanine-13C3, N-t-Boc derivative (99 & Chemical Properties |
| Melting point | 79-83 °C(lit.) | | form | solid | | Optical Rotation | [α]20/D -23°, c =2 in acetic acid | | Major Application | peptide synthesis | | InChI | 1S/C8H15NO4/c1-5(6(10)11)9-7(12)13-8(2,3)4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m0/s1/i1+1,5+1,6+1 | | InChIKey | QVHJQCGUWFKTSE-QSNIDFQTSA-N | | SMILES | CC(C)(C)OC(=O)N[13C@@H]([13CH3])[13C](O)=O | | CAS Number Unlabeled | 15761-38-3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-Alanine-13C3, N-t-Boc derivative (99 & Usage And Synthesis |
| | L-Alanine-13C3, N-t-Boc derivative (99 & Preparation Products And Raw materials |
|