| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(6-Formylpyridin-2-yl)benzonitrile, 9& Basic information |
| | 4-(6-Formylpyridin-2-yl)benzonitrile, 9& Chemical Properties |
| Melting point | 159-163 °C(lit.) | | form | solid | | InChI | 1S/C13H8N2O/c14-8-10-4-6-11(7-5-10)13-3-1-2-12(9-16)15-13/h1-7,9H | | InChIKey | PPAQGUBYGPCPLW-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1cccc(n1)-c2ccc(cc2)C#N |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(6-Formylpyridin-2-yl)benzonitrile, 9& Usage And Synthesis |
| | 4-(6-Formylpyridin-2-yl)benzonitrile, 9& Preparation Products And Raw materials |
|