| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,2-Bis(dipentafluorophenylphosphino)ethane Basic information |
| Product Name: | 1,2-Bis(dipentafluorophenylphosphino)ethane | | Synonyms: | 1,2-Bis(dipentafluorophenylphosphino)ethane,95%;98% (C6F5)2PCH2CH2P(C6F5)2;1,2-Bis(dipentafluorophenylphosphino)ethane 98%;1,2-Bis(dipentafluorophenylphosphino)ethane98%;1,2-Bis(dipentafluorophenylphosphino)ethane,99%;1,2-Bis(bis(perfluorophenyl)phosphino)ethane;1,2-Bis[bis(pentafluorophenyl)phosphino]ethane, Ethane-1,2-diylbis[bis(pentafluorophenyl)phosphane];1,2-Bis[bis(perfluorophenyl)phosphino]ethane 98% | | CAS: | 76858-94-1 | | MF: | C26H4F20P2 | | MW: | 758.23 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;organophosphine ligand;Ligand;Catalysis and Inorganic Chemistry;Phosphorus Compounds;Polydentate Phosphine Ligands | | Mol File: | 76858-94-1.mol |  |
| | 1,2-Bis(dipentafluorophenylphosphino)ethane Chemical Properties |
| Melting point | 192-195 °C(lit.) | | Boiling point | 494.2±45.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Crystalline Powder | | color | White to light beige | | Water Solubility | Insoluble in water. | | InChIKey | IGLFIYOFKVGEBP-UHFFFAOYSA-N | | SMILES | Fc1c(F)c(F)c(P(CCP(c2c(F)c(F)c(F)c(F)c2F)c3c(F)c(F)c(F)c(F)c3F)c4c(F)c(F)c(F)c(F)c4F)c(F)c1F | | CAS DataBase Reference | 76858-94-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | RIDADR | UN3464 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | 1,2-Bis(dipentafluorophenylphosphino)ethane Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | It finds it application as a pharmaceutical intermediate and intermediate in organic syntheses. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | 1,2-Bis(dipentafluorophenylphosphino)ethane Preparation Products And Raw materials |
|