| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Quinoline, 7-bromo-8-methyl- Basic information |
| | Quinoline, 7-bromo-8-methyl- Chemical Properties |
| Melting point | 47-48.5 °C | | Boiling point | 312.7±22.0 °C(Predicted) | | density | 1.488 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Methanol (Slightly), Ethyl Acetate (Slightly) | | pka | 3.47±0.31(Predicted) | | form | Solid | | color | Pale Beige | | InChI | InChI=1S/C10H8BrN/c1-7-9(11)5-4-8-3-2-6-12-10(7)8/h2-6H,1H3 | | InChIKey | MLTSRPXEANUCKX-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C(Br)C=2C)C=CC=1 |
| | Quinoline, 7-bromo-8-methyl- Usage And Synthesis |
| Chemical Properties | Yellow solid | | Uses | 7-Bromo-8-methylquinoline is a derivative of Quinoline (Q700380), a starting material that may be transformed by bacteria and fungi to produce intermediates useful for the synthesis of drugs. |
| | Quinoline, 7-bromo-8-methyl- Preparation Products And Raw materials |
|