|
|
| | 2-chloro-1-(1-chlorocyclopropyl)ethanone Basic information |
| Product Name: | 2-chloro-1-(1-chlorocyclopropyl)ethanone | | Synonyms: | Ethanone, 2-chloro-1-(1-chlorocyclopropyl)- (9CI);Ethanone, 2-chloro-1-(1-chlorocyclopropyl)-;2-CHLORO-1-(1-CHLOROCYCLOPROPYL)ETHAN-1-ONE;2-chloro-1-(1-chlorocyclopropyl) ethyl ketone;1-Chlorocyclopropyl-2-chloroethan-1-one;2-chloro-1-(1-chlorocyclopropyl)ethylone | | CAS: | 120983-72-4 | | MF: | C5H6Cl2O | | MW: | 153.01 | | EINECS: | 446-620-9 | | Product Categories: | ACETYLHALIDE | | Mol File: | 120983-72-4.mol |  |
| | 2-chloro-1-(1-chlorocyclopropyl)ethanone Chemical Properties |
| Boiling point | 202.0±20.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | vapor pressure | 80Pa at 25℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Colorless to light yellow Liquid | | Water Solubility | 5.91g/L at 20℃ | | InChI | InChI=1S/C5H6Cl2O/c6-3-4(8)5(7)1-2-5/h1-3H2 | | InChIKey | VHHGLRZRRBYTNE-UHFFFAOYSA-N | | SMILES | C(=O)(C1(Cl)CC1)CCl | | LogP | 2 at 25℃ | | EPA Substance Registry System | Ethanone, 2-chloro-1-(1-chlorocyclopropyl)- (120983-72-4) |
| | 2-chloro-1-(1-chlorocyclopropyl)ethanone Usage And Synthesis |
| Uses | 2-chloro-1-(1-chlorocyclopropyl)ethan-1-one is a chemical intermediate, mainly used for the synthesis of prothioconazole. | | Flammability and Explosibility | Not classified | | Synthesis | 2-chloro-1-(1-chlorocyclopropyl)ethan-1-one was prepared by 1-(1-chlorocyclopropyl)ethanone stirred in DCM and methanol with chlorine gas at 0℃ for 3h. |
| | 2-chloro-1-(1-chlorocyclopropyl)ethanone Preparation Products And Raw materials |
|