3-(DIETHYLAMINO)PROPANAMIDE manufacturers
|
| | 3-(DIETHYLAMINO)PROPANAMIDE Basic information |
| Product Name: | 3-(DIETHYLAMINO)PROPANAMIDE | | Synonyms: | 3-(DIETHYLAMINO)PROPANAMIDE;N3,N3-Diethyl-beta-Alaninamide;Propanamide, 3-(diethylamino)-;Metoclopramide Impurity 4;3-diethylaminopropionamide | | CAS: | 3813-27-2 | | MF: | C7H16N2O | | MW: | 144.21 | | EINECS: | | | Product Categories: | | | Mol File: | 3813-27-2.mol |  |
| | 3-(DIETHYLAMINO)PROPANAMIDE Chemical Properties |
| Boiling point | 154-157 °C(Press: 8 Torr) | | density | 0.947±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 16.37±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H16N2O/c1-3-9(4-2)6-5-7(8)10/h3-6H2,1-2H3,(H2,8,10) | | InChIKey | KTUOJDXAHZOFCA-UHFFFAOYSA-N | | SMILES | C(N)(=O)CCN(CC)CC |
| | 3-(DIETHYLAMINO)PROPANAMIDE Usage And Synthesis |
| Uses | 3-(Diethylamino)propanamide is utilized as a key intermediate in the
synthesis of pharmaceuticals, contributing to the development of new
drugs and medications. Its unique structure allows it to form essential
bonds and reactions in the creation of various medicinal compounds. |
| | 3-(DIETHYLAMINO)PROPANAMIDE Preparation Products And Raw materials |
|