|
|
| | 9,10-Dibutoxyanthracene Basic information | | Uses |
| | 9,10-Dibutoxyanthracene Chemical Properties |
| Boiling point | 478.8±18.0 °C(Predicted) | | density | 1.058±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C22H26O2/c1-3-5-15-23-21-17-11-7-9-13-19(17)22(24-16-6-4-2)20-14-10-8-12-18(20)21/h7-14H,3-6,15-16H2,1-2H3 | | InChIKey | KSMGAOMUPSQGTB-UHFFFAOYSA-N | | SMILES | C1=C2C(C(OCCCC)=C3C(=C2OCCCC)C=CC=C3)=CC=C1 |
| | 9,10-Dibutoxyanthracene Usage And Synthesis |
| Uses | 9,10-Dibutoxyanthracene is often used as an electron transfer sensitizer in photopolymerization due to its excellent optical properties. | | Chemical Properties | Yellow crystals |
| | 9,10-Dibutoxyanthracene Preparation Products And Raw materials |
|