- Methyl 2-benzoylbenzoate
-
- $0.00 / 1KG
-
2026-02-13
- CAS:606-28-0
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | Methyl 2-benzoylbenzoate Basic information |
| | Methyl 2-benzoylbenzoate Chemical Properties |
| Melting point | 48-53 °C (lit.) | | Boiling point | 352 °C | | density | 1,69 g/cm3 | | vapor pressure | 0Pa at 20℃ | | refractive index | 1.5740 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Insoluble in water | | form | powder to crystal | | color | White to Orange to Green | | Water Solubility | 117.7mg/L at 20℃ | | InChI | 1S/C15H12O3/c1-18-15(17)13-10-6-5-9-12(13)14(16)11-7-3-2-4-8-11/h2-10H,1H3 | | InChIKey | NQSMEZJWJJVYOI-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccccc1C(=O)c2ccccc2 | | LogP | 2.8 at 25℃ | | CAS DataBase Reference | 606-28-0(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 2-benzoyl-, methyl ester(606-28-0) | | EPA Substance Registry System | Methyl o-benzoylbenzoate (606-28-0) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 9 | | HS Code | 29183000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | Methyl 2-benzoylbenzoate Usage And Synthesis |
| Chemical Properties | White or yellowish granule crystals, soluble in alcohol and alkali solution, almost insoluble in water when precipitated in acid. | | Uses | Methyl 2-benzoylbenzoate is used as an anti-ultraviolet absorber and a preservative for food and beverages. | | Preparation | Methyl-2-benzoylbenzoate can be synthesized from the reaction between corresponding 2-substituted benzoic acid and thionyl chloride in methanol. | | Definition | ChEBI: Methyl 2-benzoylbenzoate is a member of benzophenones. | | General Description | Methyl-2-benzoylbenzoate is a 2-acylarylcarboxylate. It can undergo asymmetric transfer hydrogenation reaction in propanol in the presence of a Ruthenium catalyst. Methyl-2-benzoylbenzoate is formed as one of the reaction products during the reaction between methyl benzoate and lithium 2,2,6,6-tetramethylpiperidide (LiTMP) at -117°C. | | Flammability and Explosibility | Non flammable |
| | Methyl 2-benzoylbenzoate Preparation Products And Raw materials |
|