| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:PotassiuM 3-iodophenyltrifluoroborate, 96%
Package:1g Remarks:H29009
|
| Company Name: |
Jiangsu Aikon Biopharmaceutical R&D co.,Ltd.
|
| Tel: |
025-66028182 17714375163 |
| Email: |
yftan@aikonchem.com |
| Products Intro: |
Product Name:Potassium 3-iodophenyltrifluoroborate
CAS:1189097-36-6
Purity:95+% Package:1g;5g;10g
|
|
| | Potassium3-iodophenyltrifluoroborate Basic information |
| Product Name: | Potassium3-iodophenyltrifluoroborate | | Synonyms: | Potassium3-iodophenyltrifluoroborate;Potassium3-iodophenyltrifluoroborate ISO 9001：2015 REACH;Potassium trifluoro(3-iodophenyl)borate;Potassium trifluoro(3-iodophenyl)borate(1-) | | CAS: | 1189097-36-6 | | MF: | C6H4BF3IK | | MW: | 309.9049396 | | EINECS: | | | Product Categories: | | | Mol File: | 1189097-36-6.mol |  |
| | Potassium3-iodophenyltrifluoroborate Chemical Properties |
| Melting point | 202-204°C | | form | solid | | Sensitive | Light Sensitive | | InChI | 1S/C6H4BF3I.K/c8-7(9,10)5-2-1-3-6(11)4-5;/h1-4H;/q-1;+1 | | InChIKey | OREURDWJZUTVFM-UHFFFAOYSA-N | | SMILES | [K+].F[B-](F)(F)c1cccc(I)c1 |
| WGK Germany | WGK 3 | | HS Code | 2840209090 | | Storage Class | 11 - Combustible Solids |
| | Potassium3-iodophenyltrifluoroborate Usage And Synthesis |
| | Potassium3-iodophenyltrifluoroborate Preparation Products And Raw materials |
|