|
|
| | 5-BroMobenzothiophene-2-carboxylic Acid Methyl Ester Basic information |
| | 5-BroMobenzothiophene-2-carboxylic Acid Methyl Ester Chemical Properties |
| Melting point | 110 °C | | Boiling point | 358.9° | | storage temp. | 2-8°C(protect from light) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C10H7BrO2S/c1-13-10(12)9-5-6-4-7(11)2-3-8(6)14-9/h2-5H,1H3 | | InChIKey | XDYVZHUZZZKQOS-UHFFFAOYSA-N | | SMILES | C12=CC=C(Br)C=C1C=C(C(OC)=O)S2 |
| HazardClass | IRRITANT | | HS Code | 2934999090 |
| | 5-BroMobenzothiophene-2-carboxylic Acid Methyl Ester Usage And Synthesis |
| Uses | 5-Bromobenzothiophene-2-carboxylic acid methyl ester is used in the preparation of new derivatives of (heterocycle-tetrahydropyridine)-(piperazinyl)-1-alkanone and (heterocycle-dihydropyrrolidine)-(piperazinyl)-1-alkanone, as p75 neurotrophin receptor ligands for treating neurological and neurodegenerative diseases. |
| | 5-BroMobenzothiophene-2-carboxylic Acid Methyl Ester Preparation Products And Raw materials |
|