| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | rac 4-Hydroxydebrisoquine Hemisulfate Basic information |
| | rac 4-Hydroxydebrisoquine Hemisulfate Chemical Properties |
| Melting point | 262-265°C | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | color | off-white | | InChI | 1S/2C10H13N3O.H2O4S/c2*11-10(12)13-5-7-3-1-2-4-8(7)9(14)6-13;1-5(2,3)4/h2*1-4,9,14H,5-6H2,(H3,11,12);(H2,1,2,3,4) | | InChIKey | AETJLQVZNVTWPH-UHFFFAOYSA-N | | SMILES | OS(O)(=O)=O.NC(=N)N1CC(O)c2ccccc2C1.NC(=N)N3CC(O)c4ccccc4C3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | rac 4-Hydroxydebrisoquine Hemisulfate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A metabolite of Debrisoquine Sulfate, a potent antihypertenvise agent | | Uses | (±)-4-Hydroxydebrisoquin sulfate can be used for the metabolic studies of debrisoquin. | | Biochem/physiol Actions | CYP2D6 metabolite of debrisoquin. |
| | rac 4-Hydroxydebrisoquine Hemisulfate Preparation Products And Raw materials |
|