| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | trans-4-Ethyl-(1,1-bicyclohexyl)-4-carboxylic acid Basic information |
| Product Name: | trans-4-Ethyl-(1,1-bicyclohexyl)-4-carboxylic acid | | Synonyms: | (TRANS,TRANS)-4'-ETHYL-[1,1'-BICYCLOHEXYL]-4-CARBOXYLIC ACID;Trans-4-Ethyl-(1,1-Bicyclohexyl)-4-CarboxylicAcid,2HhaC15H26O2;trans-4 -ethyl-(1,1 -bicyclohexyl)-4-carboxylic acid;ALL-TRANS-4'-ETHYL-BICYCLOHEXYL-4-CARBOXYLIC ACID;2HHA;Trans-4ehtyl-(1.1bicyclohexyl)4-carboxylic acid;trans,trans-4'-Ethylbicyclohexyl-4-carboxylic Acid;trans,trans-4'-Ethylbicyclohexyl-4-carboxylic Acid | | CAS: | 84976-67-0 | | MF: | C15H26O2 | | MW: | 238.37 | | EINECS: | | | Product Categories: | Liqiud crystal intermediates | | Mol File: | 84976-67-0.mol |  |
| | trans-4-Ethyl-(1,1-bicyclohexyl)-4-carboxylic acid Chemical Properties |
| Boiling point | 355.8±10.0 °C(Predicted) | | density | 1.008±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 4.90±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C15H26O2/c1-2-11-3-5-12(6-4-11)13-7-9-14(10-8-13)15(16)17/h11-14H,2-10H2,1H3,(H,16,17)/t11-,12-,13-,14- | | InChIKey | OQIHEFMTIUJJET-HDRKRICHSA-N | | SMILES | [C@@H]1([C@@H]2CC[C@@H](CC)CC2)CC[C@@H](C(O)=O)CC1 |
| | trans-4-Ethyl-(1,1-bicyclohexyl)-4-carboxylic acid Usage And Synthesis |
| Chemical Properties | White Crysstalline | | Uses | Intermediates of Liquid Crystals |
| | trans-4-Ethyl-(1,1-bicyclohexyl)-4-carboxylic acid Preparation Products And Raw materials |
|