| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | trans-4'-Propyl-(1,1'-bicyclohexyl)-4-carboxylic acid Basic information |
| | trans-4'-Propyl-(1,1'-bicyclohexyl)-4-carboxylic acid Chemical Properties |
| Melting point | 200℃ | | Boiling point | 370.9±10.0 °C(Predicted) | | density | 0.998±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol (Sparingly) | | form | Solid | | pka | 4.90±0.10(Predicted) | | color | White | | InChI | InChI=1S/C16H28O2/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)16(17)18/h12-15H,2-11H2,1H3,(H,17,18)/t12-,13-,14-,15- | | InChIKey | JXPGQFKJNKWDKP-KTSLABGISA-N | | SMILES | [C@@H]1([C@@H]2CC[C@@H](CCC)CC2)CC[C@@H](C(O)=O)CC1 | | LogP | 6.44 |
| | trans-4'-Propyl-(1,1'-bicyclohexyl)-4-carboxylic acid Usage And Synthesis |
| Chemical Properties | White crytallized powder | | Uses | trans-4''-Propyl-(1,1''-bicyclohexyl)-4-carboxylic Acid is used for preparation of bihexyl derivatives. | | Uses | Intermediates of Liquid Crystals | | Uses | trans-4'-Propyl-(1,1'-bicyclohexyl)-4-carboxylic Acid is used for preparation of bihexyl derivatives. | | Flammability and Explosibility | Not classified |
| | trans-4'-Propyl-(1,1'-bicyclohexyl)-4-carboxylic acid Preparation Products And Raw materials |
|