| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 2-(4-Dimethylaminostyryl)-N-methylbenzoxazolium perchlorate Basic information |
| | 2-(4-Dimethylaminostyryl)-N-methylbenzoxazolium perchlorate Chemical Properties |
| Melting point | 173-174 °C (decomp) | | storage temp. | room temp | | solubility | DMSO: 10mg/mL | | form | Solid | | color | dark red | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C18H19N2O.ClHO4/c1-19(2)15-11-8-14(9-12-15)10-13-18-16-6-4-5-7-17(16)20(3)21-18;2-1(3,4)5/h4-13H,1-3H3;(H,2,3,4,5)/q+1;/p-1 | | InChIKey | FDPJLIFXRNZDJR-UHFFFAOYSA-M | | SMILES | [O-]Cl(=O)(=O)=O.CN(C)c1ccc(cc1)\C=C\c2o[n+](C)c3ccccc23 |
| Hazard Codes | Xn | | Risk Statements | 20/22-36/37/38 | | Safety Statements | 26-36 | | RIDADR | 1479 | | WGK Germany | 3 | | HazardClass | 5.1 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-(4-Dimethylaminostyryl)-N-methylbenzoxazolium perchlorate Usage And Synthesis |
| Uses | DNA, RNA stain with advantageous spectral properties for cytometric applications. |
| | 2-(4-Dimethylaminostyryl)-N-methylbenzoxazolium perchlorate Preparation Products And Raw materials |
|