| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | NSC 35051 Basic information |
| Product Name: | NSC 35051 | | Synonyms: | Alanine, 3-[p-[bis(2-chloroethyl)amino]phenyl]-, D- (8CI);CB 3026;D-Melphalan;D-Phenylalanine mustard;D-Phenylalanine, 4-[bis(2-chloroethyl)amino]- (9CI);Medphalan;NSC 35051;Medfalan | | CAS: | 13045-94-8 | | MF: | C13H18Cl2N2O2 | | MW: | 305.2 | | EINECS: | | | Product Categories: | | | Mol File: | 13045-94-8.mol |  |
| | NSC 35051 Chemical Properties |
| Melting point | 181.75°C (rough estimate) | | density | 1.3587 (rough estimate) | | refractive index | 1.6070 (estimate) | | storage temp. | 2-8°C | | InChI | InChI=1S/C13H18Cl2N2O2/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19/h1-4,12H,5-9,16H2,(H,18,19)/t12-/m1/s1 | | InChIKey | SGDBTWWWUNNDEQ-GFCCVEGCSA-N | | SMILES | C(O)(=O)[C@@H](CC1=CC=C(N(CCCl)CCCl)C=C1)N | | IARC | 3 (Vol. 9, Sup 7) 1987 |
| Toxicity | LD50 intracrebral in rat: 113ug/kg |
| | NSC 35051 Usage And Synthesis |
| Uses | D-Melphalan-d8 is the isotope labelled isomer of melphalan (M216900), which is an antineoplastic. |
| | NSC 35051 Preparation Products And Raw materials |
|