|
|
| | Dihydroxy Melphatalan Basic information |
| Product Name: | Dihydroxy Melphatalan | | Synonyms: | 4-bis(2-hydroxyethyl)amino-L-phenylalanine;Dihydroxy Melphalan;Dihydroxy melphalan-d4 (Rac);Dihydroxy Melphatalan;Melphalan EP impurity A;Melphalan Impurity 1(Melphalan EP Impurity A);(S)-2-amino-3-(4-(bis(2-hydroxyethyl)amino)phenyl)propanoic acid;Melphalan Impurity I HCl | | CAS: | 72143-20-5 | | MF: | C13H20N2O4 | | MW: | 268.31 | | EINECS: | | | Product Categories: | | | Mol File: | 72143-20-5.mol |  |
| | Dihydroxy Melphatalan Chemical Properties |
| Boiling point | 519.6±50.0 °C(Predicted) | | density | 1.318±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Methanol (Slightly), Water (Slightly) | | pka | 2.12±0.10(Predicted) | | form | Solid | | color | Orange to Brown | | InChI | InChI=1S/C13H20N2O4/c14-12(13(18)19)9-10-1-3-11(4-2-10)15(5-7-16)6-8-17/h1-4,12,16-17H,5-9,14H2,(H,18,19)/t12-/m0/s1 | | InChIKey | WHGUXSYETMNGJA-LBPRGKRZSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(N(CCO)CCO)C=C1)N |
| | Dihydroxy Melphatalan Usage And Synthesis |
| Uses | Dihydroxy Melphatalan is an analogue of Melphalan (M216900), an antineoplastic. | | Definition | ChEBI: Dihydroxymelphalan is a phenylalanine derivative. |
| | Dihydroxy Melphatalan Preparation Products And Raw materials |
|