| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
mebeverine alcohol manufacturers
|
| | mebeverine alcohol Basic information |
| | mebeverine alcohol Chemical Properties |
| storage temp. | Sealed in dry,2-8°C | | solubility | DMSO: ≥ 100 mg/mL (376.80 mM) | | form | Liquid | | color | Light yellow to yellow | | Major Application | pharmaceutical pharmaceutical small molecule | | InChI | 1S/C16H27NO2/c1-4-17(11-5-6-12-18)14(2)13-15-7-9-16(19-3)10-8-15/h7-10,14,18H,4-6,11-13H2,1-3H3 | | InChIKey | ZGZAPRVKIAFOPL-UHFFFAOYSA-N | | SMILES | N(C(Cc1ccc(cc1)OC)C)(CCCCO)CC |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | mebeverine alcohol Usage And Synthesis |
| Chemical Properties | Light Yellow Oil | | Uses | Labelled Mebeverine Alcohol, a metabolite of Mebeverine (M202490), an antispasmodic. |
| | mebeverine alcohol Preparation Products And Raw materials |
|