5,5'-oxybis(5-methylene-2-furaldehyde) manufacturers
- Cirsiumaldehyde
-
- $29.00
-
2026-05-11
- CAS:7389-38-0
- Purity: 99.98%
- Supply Ability: 10g
|
| | 5,5'-oxybis(5-methylene-2-furaldehyde) Basic information |
| Product Name: | 5,5'-oxybis(5-methylene-2-furaldehyde) | | Synonyms: | 5,5'-oxybis(5-methylene-2-furaldehyde);5,5'-oxydiMethylenebis(2-furfural);Furfural Impurity 3;2-Furancarboxaldehyde, 5,5'-[oxybis(methylene)]bis-;5, 5'(oxy-bis(methylene))bis-2-furfural;5,5'-(methoxymethylene)bis(furan-2-carbaldehyde);5-[(5-formylfuran-2-yl)methoxymethyl]furan-2-carbaldehyde;Bis - (5-formylfuryl) ether | | CAS: | 7389-38-0 | | MF: | C12H10O5 | | MW: | 234.21 | | EINECS: | | | Product Categories: | | | Mol File: | 7389-38-0.mol |  |
| | 5,5'-oxybis(5-methylene-2-furaldehyde) Chemical Properties |
| Melting point | 113.5-115.5 °C | | Boiling point | 404.8±45.0 °C(Predicted) | | density | 1.313±0.06 g/cm3(Predicted) | | form | Solid | | color | Light brown to brown | | InChI | InChI=1S/C12H10O5/c13-5-9-1-3-11(16-9)7-15-8-12-4-2-10(6-14)17-12/h1-6H,7-8H2 | | InChIKey | TZTWOBUHCLWLNK-UHFFFAOYSA-N | | SMILES | O(CC1OC(C=O)=CC=1)CC1OC(C=O)=CC=1 |
| | 5,5'-oxybis(5-methylene-2-furaldehyde) Usage And Synthesis |
| Chemical Properties | Light yellow powder. | | Uses | Cirsiumaldehyde is a useful research chemical compound. | | Application | Cirsiumaldehyde from the etherification of 5-hydroxymethylfurfural can be used as raw materials to prepare polyamide and polyimide bio-based polymeric materials and can also be used to synthesize heterocyclic ligands and hepatitis antiviral precursors. | | Source | Cirsiumaldehyde is found in TyphoniiRhizoma. |
| | 5,5'-oxybis(5-methylene-2-furaldehyde) Preparation Products And Raw materials |
|