| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
penicillin X manufacturers
|
| | penicillin X Basic information |
| Product Name: | penicillin X | | Synonyms: | penicillin X;(2S,5β)-6α-[[(4-Hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2β-carboxylic acid;4-Hydroxybenzylpenicillin;6α-[(4-Hydroxyphenyl)acetylamino]penicillanic acid;Penicillin III;4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[[2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-, (2S,5R,6R)-;Benzathine Benzylpenicillin EP Impurity GQ: What is
Benzathine Benzylpenicillin EP Impurity G Q: What is the CAS Number of
Benzathine Benzylpenicillin EP Impurity G;Penicillin x (penicillin impurity 1) | | CAS: | 525-91-7 | | MF: | C16H18N2O5S | | MW: | 350.39 | | EINECS: | | | Product Categories: | | | Mol File: | 525-91-7.mol |  |
| | penicillin X Chemical Properties |
| storage temp. | -20°C | | InChI | 1S/C16H18N2O5S/c1-16(2)12(15(22)23)18-13(21)11(14(18)24-16)17-10(20)7-8-3-5-9(19)6-4-8/h3-6,11-12,14,19H,7H2,1-2H3,(H,17,20)(H,22,23)/t11-,12+,14-/m1/s1 | | InChIKey | AZCVBVRUYHKWHU-MBNYWOFBSA-N | | SMILES | S1[C@H]2N([C@H](C1(C)C)C(=O)O)C(=O)[C@H]2NC(=O)Cc3ccc(cc3)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Resp. Sens. 1
Skin Sens. 1 |
| | penicillin X Usage And Synthesis |
| Uses | Penicillin X is the penicillin of choice in the treatment of infections with pneumococcus Type I and hemolytic streptococci. 6. | | Definition | ChEBI: Penicillin X is a penicillin. |
| | penicillin X Preparation Products And Raw materials |
|