- 4,4'-DIBROMOBENZIL
-
- $6.60 / 1KG
-
2019-12-31
- CAS: 35578-47-3
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| | 4,4'-DIBROMOBENZIL Basic information |
| | 4,4'-DIBROMOBENZIL Chemical Properties |
| Melting point | 224-226 °C(lit.) | | Boiling point | 457.2±30.0 °C(Predicted) | | density | 1.6983 (rough estimate) | | refractive index | 1.4947 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | color | Yellow | | Water Solubility | Sparingly soluble in water. | | InChI | InChI=1S/C14H8Br2O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8H | | InChIKey | NYCBYBDDECLFPE-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Br)C=C1)(=O)C(C1=CC=C(Br)C=C1)=O | | CAS DataBase Reference | 35578-47-3(CAS DataBase Reference) | | EPA Substance Registry System | Ethanedione, bis(4-bromophenyl)- (35578-47-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 29147000 |
| | 4,4'-DIBROMOBENZIL Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | 4,4?-Dibromobenzil was used in preparation of 5,5?-bis?-(4-bromo-phenyl)-3-methyl-imidazolidine-2,4-dione, 5,5?-?bis?-(4-bromo-phenyl)-3-butyl-imidazolidine-2,4-dione,?5,5?-bis-(4-bromo-phenyl)-3-pentyl-imidazolidine-2,4-dione and 5,5?-bis?-(4-chloro-phenyl)-3-ethyl imidazolidine-2,4-dione.?It was also used in synthesis of novel quinoxaline-based sensitizers for dye-sensitized solar cells. | | Uses | 4,4′-Dibromobenzil was used in preparation of 5,5′-bis -(4-bromo-phenyl)-3-methyl-imidazolidine-2,4-dione, 5,5′- bis -(4-bromo-phenyl)-3-butyl-imidazolidine-2,4-dione, 5,5′-bis-(4-bromo-phenyl)-3-pentyl-imidazolidine-2,4-dione and 5,5′-bis -(4-chloro-phenyl)-3-ethyl imidazolidine-2,4-dione. It was also used in synthesis of novel quinoxaline-based sensitizers for dye-sensitized solar cells. |
| | 4,4'-DIBROMOBENZIL Preparation Products And Raw materials |
|