| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
1-(8-Chloro-10,11-dihydrodibenzo[b,f]thiepin-10-yl)-4-methyl-piperazine maleate manufacturers
|
| | 1-(8-Chloro-10,11-dihydrodibenzo[b,f]thiepin-10-yl)-4-methyl-piperazine maleate Basic information |
| Product Name: | 1-(8-Chloro-10,11-dihydrodibenzo[b,f]thiepin-10-yl)-4-methyl-piperazine maleate | | Synonyms: | 1-(8-chloro-10,11-dihydrodibenzo(b,f)thiepin-10-yl)-4-methyl-piperazinmale;8-chloro-10-(4-methylpiperazino)-10,11-dihydrodibenzo(b,f)thiepinmaleate;d,l-8-chloro-10-(4-methylpiperazino)-10,11-dihydrodibenzo(b,f)thiepinmaleate;octoclothepinemaleate;vufb-6281;OCTOCLOTHEPIN MALEATE;OCTOCLOTHEPIN MALEATE SALT;OCTOCLOTHEPIN MALEATE D2 DOPAMINE ANTAGO NIS | | CAS: | 4789-68-8 | | MF: | C23H25ClN2O4S | | MW: | 460.97 | | EINECS: | | | Product Categories: | | | Mol File: | 4789-68-8.mol | ![1-(8-Chloro-10,11-dihydrodibenzo[b,f]thiepin-10-yl)-4-methyl-piperazine maleate Structure](CAS/GIF/4789-68-8.gif) |
| | 1-(8-Chloro-10,11-dihydrodibenzo[b,f]thiepin-10-yl)-4-methyl-piperazine maleate Chemical Properties |
| solubility | 45% (w/v) aq 2-hydroxypropyl-β-cyclodextrin: >21 mg/mL | | form | solid | | color | white | | InChI | 1S/C19H21ClN2S.C4H4O4/c1-21-8-10-22(11-9-21)17-12-14-4-2-3-5-18(14)23-19-7-6-15(20)13-16(17)19;5-3(6)1-2-4(7)8/h2-7,13,17H,8-12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- | | InChIKey | GWKBZIADWSOIQV-BTJKTKAUSA-N | | SMILES | [H]\C(=C(/[H])C(O)=O)C(O)=O.CN1CCN(CC1)C2Cc3ccccc3Sc4ccc(Cl)cc24 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 36/37/39-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | TL1575000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-(8-Chloro-10,11-dihydrodibenzo[b,f]thiepin-10-yl)-4-methyl-piperazine maleate Usage And Synthesis |
| Uses | Octoclothepin Maleate Salt is an SR-2A inhibitor as well as a D2DR inhibitor. | | Biological Activity | D2 dopamine receptor antagonist; 5-HT2 serotonin receptor antagonist. | | in vivo | Octoclothepin possesses high cataleptogenic and anti-apomorphine activities in rats; it is able to exert full protection against apomorphine-induced emesis in dogs after the dose of 0.1 mg/kg s.c.[1].
Octoclothepin in doses of 0.5 and 1.5 mg/kg s.c. reduces the DA level and raises the HVA and DOPAC levels significantly[1].
|
| | 1-(8-Chloro-10,11-dihydrodibenzo[b,f]thiepin-10-yl)-4-methyl-piperazine maleate Preparation Products And Raw materials |
|