| Company Name: |
ChemeGen Gold |
| Tel: |
18818260767 |
| Email: |
2625930290@qq.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | 7-Dechloro Griseofulvin Basic information |
| Product Name: | 7-Dechloro Griseofulvin | | Synonyms: | 2',4,6-Trimethoxy-6'-methylspiro[benzofuran-2(3H),1'-[2]cyclohexene]-3,4'-dione;7-Dechloro Griseofulvin;(1'S,6'R)-2',4,6-TriMethoxy-6'-Methylspiro[benzofuran-2(3H),1'-[2]cyclohexene]-3,4'-dione;(1'S-trans)-2',4,6-TriMethoxy-6'-Methylspiro[benzofuran-2(3H),1'-
[2]cyclohexene]-3,4'-dione;(2S,6'R)-2',4,6-trimethoxy-6'-methyl-3H-spiro[benzofuran-2,1'-cyclohexan]-2'-ene-3,4'-dione;Griseofulvin ImpuritⅠ: (1'S,6'R)-2',4,6-Trimethoxy-6'-methylspiro[benzofuran-2(3H),1'-[2]cyclohexene]-3,4'-dione )( 7-Dechloro Griseofulvin);Griseofulvin 7-Dechloro Impurity;Griseofulvin ImpuritⅠ: (1’S,6’R)-2’,4,6-Trimethoxy-6’-methylspiro[benzofuran-2(3H),1’-[2]cyclohexene]-3,4’-dione )( 7-Dechloro Griseofulvin) | | CAS: | 3680-32-8 | | MF: | C17H18O6 | | MW: | 318.32 | | EINECS: | | | Product Categories: | Aromatics;Chiral Reagents;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 3680-32-8.mol |  |
| | 7-Dechloro Griseofulvin Chemical Properties |
| Melting point | 177-179°C | | Boiling point | 545.4±50.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Acetone (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly, Heated) | | form | Solid | | color | White to Off-White | | Water Solubility | water: slightly soluble | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChI | InChI=1S/C17H18O6/c1-9-5-10(18)6-14(22-4)17(9)16(19)15-12(21-3)7-11(20-2)8-13(15)23-17/h6-9H,5H2,1-4H3 | | InChIKey | QPCYNIYZPDJCMB-UHFFFAOYSA-N | | SMILES | O1C2=CC(OC)=CC(OC)=C2C(=O)C21C(C)CC(=O)C=C2OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 7-Dechloro Griseofulvin Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A major photoproduct (impurity) of Griseofulvin (G787500). | | Biological Activity | Dechlorogriseofulvin functions by inhibiting microtubule assembly, causing disruption in cell division and growth. |
| | 7-Dechloro Griseofulvin Preparation Products And Raw materials |
|