Batatasin I manufacturers
- Batatasin I
-
- $2500.00
-
2024-11-28
- CAS:51415-00-0
- Min. Order: 1g
- Purity: 98 %
- Supply Ability: 50 Kg
|
| | Batatasin I Basic information |
| Product Name: | Batatasin I | | Synonyms: | Batatasin I;2,5,7-Trimethoxyphenanthren-3-ol;3-Phenanthrenol, 2,5,7-trimethoxy- | | CAS: | 51415-00-0 | | MF: | C17H16O4 | | MW: | 284.31 | | EINECS: | | | Product Categories: | | | Mol File: | 51415-00-0.mol |  |
| | Batatasin I Chemical Properties |
| Melting point | 131-132 °C | | Boiling point | 493.7±40.0 °C(Predicted) | | density | 1.246±0.06 g/cm3(Predicted) | | pka | 9.33±0.30(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C17H16O4/c1-19-12-6-11-5-4-10-7-15(20-2)14(18)9-13(10)17(11)16(8-12)21-3/h4-9,18H,1-3H3 | | InChIKey | KGYHMWVRKYFQQR-UHFFFAOYSA-N | | SMILES | C1=C2C(C3C(C=C2)=CC(OC)=CC=3OC)=CC(O)=C1OC |
| | Batatasin I Usage And Synthesis |
| Uses | Batatasin I is a naturally occurring phenanthrene derivative that is isolated from tuberous roots of Dioscorea batatas. It suppresses eicosanoids generation and degranulation in bone marrow derived-mast cells and has potential antimicrobial activity. | | Definition | ChEBI: Batatasin I is a phenanthrol. |
| | Batatasin I Preparation Products And Raw materials |
|