|
|
| | S-Fukinolide Basic information |
| Product Name: | S-Fukinolide | | Synonyms: | S-Fukinolide;(-)-Bakkenolide D;(1'R,3R,7'aβ)-1'β-Acetoxy-3'aβ,4'β-dimethyl-4-methylene-7'α-[[(2Z)-3-(methylthio)acryloyl]oxy]spiro[oxolane-3,2'-hydrindane]-2-one;(Z)-3-Methylthiopropenoic acid [(3R,3'aα)-3'α-acetoxy-4,5,1',3',3'a,4',5',6',7',7'a-decahydro-7'α,7'aα-dimethyl-4-methylene-2-oxospiro[furan-3(2H),2'-[2H]inden]-4'β-yl] ester;S-Fukinolid;2-Propenoic acid, 3-(methylthio)-, (2'R,3'R,3'aR,4'S,7'S,7'aR)-3'-(acetyloxy)decahydro-7',7'a-dimethyl-4-methylene-2-oxospiro[furan-3(2H),2'-[2H]inden]-4'-yl ester, (2Z)-;Spironolactone EP Impurity 14;Bakkenolide D | | CAS: | 18456-03-6 | | MF: | C21H28O6S | | MW: | 408.51 | | EINECS: | | | Product Categories: | | | Mol File: | 18456-03-6.mol |  |
| | S-Fukinolide Chemical Properties |
| Melting point | 200-201℃ | | Boiling point | 539.1±50.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | InChIKey | LWHLMCCRIWZBQO-PDSBHGERSA-N | | SMILES | C(O[C@H]1CC[C@H](C)[C@]2(C)[C@@]1([H])[C@@H](OC(C)=O)[C@@]1(C2)C(=C)COC1=O)(=O)/C=C\SC |
| | S-Fukinolide Usage And Synthesis |
| Uses | Bakkenolide D is the main component of bakkenolide in Petasites tricholobus. Bakkenolide has anti-allergic effects and can be used in the study of allergic rhinitis[1]. | | target | IL Receptor | Histamine Receptor | | References | [1] Zhang FJ, et al. Anti-allergic effects of total bakkenolides from Petasites tricholobus in ovalbumin-sensitized rats. Phytother Res. 2011 Jan;25(1):116-21. DOI:10.1002/ptr.3237 |
| | S-Fukinolide Preparation Products And Raw materials |
|